C13H12N6O3S — CID 9128205
N-(furan-2-ylmethylcarbamoyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 9128205) has the molecular formula C13H12N6O3S and a molecular weight of 332.34 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamoyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-(furan-2-ylmethylcarbamoyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9128205 |
| Molecular Formula | C13H12N6O3S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(furan-2-ylmethylcarbamoyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccsc2)n1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C13H12N6O3S/c20-11(15-13(21)14-6-10-2-1-4-22-10)7-19-17-12(16-18-19)9-3-5-23-8-9/h1-5,8H,6-7H2,(H2,14,15,20,21) |
| InChIKey | PEPLCGBEKVKCGX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |