About tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate
tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate (PubChem CID 91282357) has the molecular formula C20H30O6
and a molecular weight of 366.45 g/mol. Its IUPAC name is tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate.
Molecular Properties
| Compound Name | tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate |
| PubChem CID | 91282357 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate |
| SMILES | CC(=O)OC(C(C)=O)(C(=O)C=C(C)CCC=C(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30O6/c1-13(2)10-9-11-14(3)12-17(23)20(15(4)21,25-16(5)22)18(24)26-19(6,7)8/h10,12H,9,11H2,1-8H3 |
| InChIKey | SEIIQFRLTKACKI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate?
The IUPAC name of tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate (CID 91282357) is tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate.
What is the SMILES notation for tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate?
The canonical SMILES for tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate is CC(=O)OC(C(C)=O)(C(=O)C=C(C)CCC=C(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate?
The InChIKey is SEIIQFRLTKACKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O6/c1-13(2)10-9-11-14(3)12-17(23)20(15(4)21,25-16(5)22)18(24)26-19(6,7)8/h10,12H,9,11H2,1-8H3.
What are the key properties of tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate?
tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate has a molecular weight of 366.45 g/mol, XLogP of 3.48, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-acetyl-2-acetyloxy-5,9-dimethyl-3-oxodeca-4,8-dienoate is sourced from PubChem (CID 91282357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).