C23H18F3N5O3S — CID 91282632
N'-[4-[[4-hydroxy-2-oxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-1-yl]methyl]-2-pyridinyl]benzohydrazide (PubChem CID 91282632) has the molecular formula C23H18F3N5O3S and a molecular weight of 501.49 g/mol. Its IUPAC name is N'-[4-[[4-hydroxy-2-oxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-1-yl]methyl]-2-pyridinyl]benzohydrazide.
| Compound Name | N'-[4-[[4-hydroxy-2-oxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-1-yl]methyl]-2-pyridinyl]benzohydrazide |
|---|---|
| PubChem CID | 91282632 |
| Molecular Formula | C23H18F3N5O3S |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | N'-[4-[[4-hydroxy-2-oxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazol-1-yl]methyl]-2-pyridinyl]benzohydrazide |
| SMILES | O=C(NNc1cc(Cn2cc(O)n(-c3ccc(SC(F)(F)F)cc3)c2=O)ccn1)c1ccccc1 |
| InChI | InChI=1S/C23H18F3N5O3S/c24-23(25,26)35-18-8-6-17(7-9-18)31-20(32)14-30(22(31)34)13-15-10-11-27-19(12-15)28-29-21(33)16-4-2-1-3-5-16/h1-12,14,32H,13H2,(H,27,28)(H,29,33) |
| InChIKey | MZKNFDXFSKVLPJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|