About (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate
(4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate (PubChem CID 91283266) has the molecular formula C17H21F2N3O2
and a molecular weight of 337.37 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate.
Molecular Properties
| Compound Name | (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate |
| PubChem CID | 91283266 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate |
| SMILES | CC(C)(C)N(C(=O)Oc1cc(F)c(C#N)c(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C17H21F2N3O2/c1-17(2,3)22(11-4-6-21-7-5-11)16(23)24-12-8-14(18)13(10-20)15(19)9-12/h8-9,11,21H,4-7H2,1-3H3 |
| InChIKey | JCTNHQNFVXLLSR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate?
The IUPAC name of (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate (CID 91283266) is (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate.
What is the SMILES notation for (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate?
The canonical SMILES for (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate is CC(C)(C)N(C(=O)Oc1cc(F)c(C#N)c(F)c1)C1CCNCC1.
What is the InChIKey of (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate?
The InChIKey is JCTNHQNFVXLLSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O2/c1-17(2,3)22(11-4-6-21-7-5-11)16(23)24-12-8-14(18)13(10-20)15(19)9-12/h8-9,11,21H,4-7H2,1-3H3.
What are the key properties of (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate?
(4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate has a molecular weight of 337.37 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-3,5-difluorophenyl) N-tert-butyl-N-piperidin-4-ylcarbamate is sourced from PubChem (CID 91283266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).