C40H37N4O2P — CID 91283427
ethane;ethyl 5-(6-phenylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-3-carboxylate;triphenylphosphane (PubChem CID 91283427) has the molecular formula C40H37N4O2P and a molecular weight of 636.74 g/mol. Its IUPAC name is ethane;ethyl 5-(6-phenylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-3-carboxylate;triphenylphosphane.
| Compound Name | ethane;ethyl 5-(6-phenylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-3-carboxylate;triphenylphosphane |
|---|---|
| PubChem CID | 91283427 |
| Molecular Formula | C40H37N4O2P |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | ethane;ethyl 5-(6-phenylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-3-carboxylate;triphenylphosphane |
| SMILES | CC.CCOC(=O)c1cncc(-c2cnn3cc(-c4ccccc4)cnc23)c1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N4O2.C18H15P.C2H6/c1-2-26-20(25)16-8-15(9-21-10-16)18-12-23-24-13-17(11-22-19(18)24)14-6-4-3-5-7-14;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2/h3-13H,2H2,1H3;1-15H;1-2H3 |
| InChIKey | CLOLJANVZQWLOO-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|