C10H18N2O7 — CID 91283733
2-[4-hydroxy-2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]propanamide (PubChem CID 91283733) has the molecular formula C10H18N2O7 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-[4-hydroxy-2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]propanamide.
| Compound Name | 2-[4-hydroxy-2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 91283733 |
| Molecular Formula | C10H18N2O7 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[4-hydroxy-2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]propanamide |
| SMILES | CC(C(N)=O)N1CC(O)(C(O)(O)C(C)(O)O)CC1=O |
| InChI | InChI=1S/C10H18N2O7/c1-5(7(11)14)12-4-9(17,3-6(12)13)10(18,19)8(2,15)16/h5,15-19H,3-4H2,1-2H3,(H2,11,14) |
| InChIKey | BNNZMBJGGYPCFL-UHFFFAOYSA-N |
| XLogP | -3.79 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|