C26H19F2NO5S — CID 91284065
[3-methoxycarbonyl-4-[2-(methoxymethyl)-5-pyridin-3-ylthiophen-3-yl]phenyl] 2,6-difluorobenzoate (PubChem CID 91284065) has the molecular formula C26H19F2NO5S and a molecular weight of 495.50 g/mol. Its IUPAC name is [3-methoxycarbonyl-4-[2-(methoxymethyl)-5-pyridin-3-ylthiophen-3-yl]phenyl] 2,6-difluorobenzoate.
| Compound Name | [3-methoxycarbonyl-4-[2-(methoxymethyl)-5-pyridin-3-ylthiophen-3-yl]phenyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 91284065 |
| Molecular Formula | C26H19F2NO5S |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | [3-methoxycarbonyl-4-[2-(methoxymethyl)-5-pyridin-3-ylthiophen-3-yl]phenyl] 2,6-difluorobenzoate |
| SMILES | COCc1sc(-c2cccnc2)cc1-c1ccc(OC(=O)c2c(F)cccc2F)cc1C(=O)OC |
| InChI | InChI=1S/C26H19F2NO5S/c1-32-14-23-18(12-22(35-23)15-5-4-10-29-13-15)17-9-8-16(11-19(17)25(30)33-2)34-26(31)24-20(27)6-3-7-21(24)28/h3-13H,14H2,1-2H3 |
| InChIKey | RNFMLUOFCRAKIX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|