C32H36F3N5O4 — CID 91284288
tert-butyl (2S)-2-[[2-[6-[(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)amino]pyrimidin-4-yl]-5-(trifluoromethyl)phenyl]carbamoyl]-5-methylpyrrolidine-1-carboxylate (PubChem CID 91284288) has the molecular formula C32H36F3N5O4 and a molecular weight of 611.67 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[6-[(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)amino]pyrimidin-4-yl]-5-(trifluoromethyl)phenyl]carbamoyl]-5-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[2-[6-[(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)amino]pyrimidin-4-yl]-5-(trifluoromethyl)phenyl]carbamoyl]-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91284288 |
| Molecular Formula | C32H36F3N5O4 |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[6-[(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)amino]pyrimidin-4-yl]-5-(trifluoromethyl)phenyl]carbamoyl]-5-methylpyrrolidine-1-carboxylate |
| SMILES | CC1CC[C@@H](C(=O)Nc2cc(C(F)(F)F)ccc2-c2cc(Nc3cccc4c3CC(O)CC4)ncn2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H36F3N5O4/c1-18-8-13-27(40(18)30(43)44-31(2,3)4)29(42)39-26-14-20(32(33,34)35)10-12-22(26)25-16-28(37-17-36-25)38-24-7-5-6-19-9-11-21(41)15-23(19)24/h5-7,10,12,14,16-18,21,27,41H,8-9,11,13,15H2,1-4H3,(H,39,42)(H,36,37,38)/t18?,21?,27-/m0/s1 |
| InChIKey | LOIANQGVYZARJT-LCGZVINYSA-N |
| XLogP | 6.48 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |