C10H14N2 — CID 91284564
4-(2,3,4,5-tetrahydropyridin-2-yl)-2,5-dihydropyridine (PubChem CID 91284564) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 4-(2,3,4,5-tetrahydropyridin-2-yl)-2,5-dihydropyridine.
| Compound Name | 4-(2,3,4,5-tetrahydropyridin-2-yl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 91284564 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 4-(2,3,4,5-tetrahydropyridin-2-yl)-2,5-dihydropyridine |
| SMILES | C1=NCC=C(C2CCCC=N2)C1 |
| InChI | InChI=1S/C10H14N2/c1-2-6-12-10(3-1)9-4-7-11-8-5-9/h4,6,8,10H,1-3,5,7H2 |
| InChIKey | CRSVNHOGIQKYDQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|