C33H29N3O2S — CID 91284659
3-[3-[2-(2-aminophenyl)-1-(2-phenylethylsulfanyl)ethyl]-1H-indol-2-yl]-1H-indole-5-carboxylic acid (PubChem CID 91284659) has the molecular formula C33H29N3O2S and a molecular weight of 531.68 g/mol. Its IUPAC name is 3-[3-[2-(2-aminophenyl)-1-(2-phenylethylsulfanyl)ethyl]-1H-indol-2-yl]-1H-indole-5-carboxylic acid.
| Compound Name | 3-[3-[2-(2-aminophenyl)-1-(2-phenylethylsulfanyl)ethyl]-1H-indol-2-yl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 91284659 |
| Molecular Formula | C33H29N3O2S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 3-[3-[2-(2-aminophenyl)-1-(2-phenylethylsulfanyl)ethyl]-1H-indol-2-yl]-1H-indole-5-carboxylic acid |
| SMILES | Nc1ccccc1CC(SCCc1ccccc1)c1c(-c2c[nH]c3ccc(C(=O)O)cc23)[nH]c2ccccc12 |
| InChI | InChI=1S/C33H29N3O2S/c34-27-12-6-4-10-22(27)19-30(39-17-16-21-8-2-1-3-9-21)31-24-11-5-7-13-29(24)36-32(31)26-20-35-28-15-14-23(33(37)38)18-25(26)28/h1-15,18,20,30,35-36H,16-17,19,34H2,(H,37,38) |
| InChIKey | VAOBPSRUPFQVFQ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|