About 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene
3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene (PubChem CID 91284684) has the molecular formula C19H20F2O
and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene.
Molecular Properties
| Compound Name | 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene |
| PubChem CID | 91284684 |
| Molecular Formula | C19H20F2O |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene |
| SMILES | CCc1ccc2c(c1F)COc1c-2ccc(C(C)(C)C)c1F |
| InChI | InChI=1S/C19H20F2O/c1-5-11-6-7-12-13-8-9-15(19(2,3)4)17(21)18(13)22-10-14(12)16(11)20/h6-9H,5,10H2,1-4H3 |
| InChIKey | RLZVXXRBORHBEV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene?
The IUPAC name of 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene (CID 91284684) is 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene.
What is the SMILES notation for 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene?
The canonical SMILES for 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene is CCc1ccc2c(c1F)COc1c-2ccc(C(C)(C)C)c1F.
What is the InChIKey of 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene?
The InChIKey is RLZVXXRBORHBEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2O/c1-5-11-6-7-12-13-8-9-15(19(2,3)4)17(21)18(13)22-10-14(12)16(11)20/h6-9H,5,10H2,1-4H3.
What are the key properties of 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene?
3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene has a molecular weight of 302.36 g/mol, XLogP of 5.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-8-ethyl-4,7-difluoro-6H-benzo[c]chromene is sourced from PubChem (CID 91284684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).