C12H20 — CID 91284791
5-ethyl-1,3a,4,5,6,7,8,8a-octahydroazulene (PubChem CID 91284791) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 5-ethyl-1,3a,4,5,6,7,8,8a-octahydroazulene.
| Compound Name | 5-ethyl-1,3a,4,5,6,7,8,8a-octahydroazulene |
|---|---|
| PubChem CID | 91284791 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 5-ethyl-1,3a,4,5,6,7,8,8a-octahydroazulene |
| SMILES | CCC1CCCC2CC=CC2C1 |
| InChI | InChI=1S/C12H20/c1-2-10-5-3-6-11-7-4-8-12(11)9-10/h4,8,10-12H,2-3,5-7,9H2,1H3 |
| InChIKey | GNFHGXMIRUMIHZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|