C69H51N8O+ — CID 91284928
3-[2-[3,5-bis(1-phenylbenzimidazol-2-yl)phenyl]-3-phenylbenzimidazol-5-yl]-5-(4-tert-butylphenyl)-2-(4-phenylphenyl)-1,3,4-oxadiazol-3-ium (PubChem CID 91284928) has the molecular formula C69H51N8O+ and a molecular weight of 1008.22 g/mol. Its IUPAC name is 3-[2-[3,5-bis(1-phenylbenzimidazol-2-yl)phenyl]-3-phenylbenzimidazol-5-yl]-5-(4-tert-butylphenyl)-2-(4-phenylphenyl)-1,3,4-oxadiazol-3-ium.
| Compound Name | 3-[2-[3,5-bis(1-phenylbenzimidazol-2-yl)phenyl]-3-phenylbenzimidazol-5-yl]-5-(4-tert-butylphenyl)-2-(4-phenylphenyl)-1,3,4-oxadiazol-3-ium |
|---|---|
| PubChem CID | 91284928 |
| Molecular Formula | C69H51N8O+ |
| Molecular Weight | 1008.22 g/mol |
| Exact Mass | 1007.42 |
| IUPAC Name | 3-[2-[3,5-bis(1-phenylbenzimidazol-2-yl)phenyl]-3-phenylbenzimidazol-5-yl]-5-(4-tert-butylphenyl)-2-(4-phenylphenyl)-1,3,4-oxadiazol-3-ium |
| SMILES | CC(C)(C)c1ccc(-c2n[n+](-c3ccc4nc(-c5cc(-c6nc7ccccc7n6-c6ccccc6)cc(-c6nc7ccccc7n6-c6ccccc6)c5)n(-c5ccccc5)c4c3)c(-c3ccc(-c4ccccc4)cc3)o2)cc1 |
| InChI | InChI=1S/C69H51N8O/c1-69(2,3)53-38-36-48(37-39-53)67-73-77(68(78-67)49-34-32-47(33-35-49)46-20-8-4-9-21-46)57-40-41-60-63(45-57)76(56-26-14-7-15-27-56)66(72-60)52-43-50(64-70-58-28-16-18-30-61(58)74(64)54-22-10-5-11-23-54)42-51(44-52)65-71-59-29-17-19-31-62(59)75(65)55-24-12-6-13-25-55/h4-45H,1-3H3/q+1 |
| InChIKey | POOYJFNSFZCEAX-UHFFFAOYSA-N |
| XLogP | 16.27 |
| TPSA | 83.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.22 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|