C19H17N3OS2 — CID 91285126
N-(6,6-dithiophen-2-yl-1,7-dihydroindazol-3-yl)cyclopropanecarboxamide (PubChem CID 91285126) has the molecular formula C19H17N3OS2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-(6,6-dithiophen-2-yl-1,7-dihydroindazol-3-yl)cyclopropanecarboxamide.
| Compound Name | N-(6,6-dithiophen-2-yl-1,7-dihydroindazol-3-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 91285126 |
| Molecular Formula | C19H17N3OS2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-(6,6-dithiophen-2-yl-1,7-dihydroindazol-3-yl)cyclopropanecarboxamide |
| SMILES | O=C(Nc1n[nH]c2c1C=CC(c1cccs1)(c1cccs1)C2)C1CC1 |
| InChI | InChI=1S/C19H17N3OS2/c23-18(12-5-6-12)20-17-13-7-8-19(11-14(13)21-22-17,15-3-1-9-24-15)16-4-2-10-25-16/h1-4,7-10,12H,5-6,11H2,(H2,20,21,22,23) |
| InChIKey | KZJTZLBOOQALTO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |