C7H12N2 — CID 91285292
1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyridine (PubChem CID 91285292) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyridine.
| Compound Name | 1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 91285292 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1,2,4,5,6,7-hexahydropyrazolo[1,5-a]pyridine |
| SMILES | C1=C2CCCCN2NC1 |
| InChI | InChI=1S/C7H12N2/c1-2-6-9-7(3-1)4-5-8-9/h4,8H,1-3,5-6H2 |
| InChIKey | BLPITRJJHRZBEW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |