C24H18F2NO5S- — CID 91285826
4-[6-[2-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-3-methyl-2-pyridinyl]benzenesulfinate (PubChem CID 91285826) has the molecular formula C24H18F2NO5S- and a molecular weight of 470.47 g/mol. Its IUPAC name is 4-[6-[2-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-3-methyl-2-pyridinyl]benzenesulfinate.
| Compound Name | 4-[6-[2-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-3-methyl-2-pyridinyl]benzenesulfinate |
|---|---|
| PubChem CID | 91285826 |
| Molecular Formula | C24H18F2NO5S- |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 4-[6-[2-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-3-methyl-2-pyridinyl]benzenesulfinate |
| SMILES | Cc1ccc(CC(=O)C2(c3ccc4c(c3)OC(F)(F)O4)CC2)nc1-c1ccc(S(=O)[O-])cc1 |
| InChI | InChI=1S/C24H19F2NO5S/c1-14-2-6-17(27-22(14)15-3-7-18(8-4-15)33(29)30)13-21(28)23(10-11-23)16-5-9-19-20(12-16)32-24(25,26)31-19/h2-9,12H,10-11,13H2,1H3,(H,29,30)/p-1 |
| InChIKey | IGTWHPSEMGSPQP-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 88.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|