C41H62N6O5 — CID 91285831
(2,6-ditert-butylcyclohexyl) 2-(4-tert-butyl-2-methylphenyl)-5-(diethylcarbamoyloxy)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate;N,N-dimethylacetamide (PubChem CID 91285831) has the molecular formula C41H62N6O5 and a molecular weight of 718.98 g/mol. Its IUPAC name is (2,6-ditert-butylcyclohexyl) 2-(4-tert-butyl-2-methylphenyl)-5-(diethylcarbamoyloxy)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate;N,N-dimethylacetamide.
| Compound Name | (2,6-ditert-butylcyclohexyl) 2-(4-tert-butyl-2-methylphenyl)-5-(diethylcarbamoyloxy)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate;N,N-dimethylacetamide |
|---|---|
| PubChem CID | 91285831 |
| Molecular Formula | C41H62N6O5 |
| Molecular Weight | 718.98 g/mol |
| Exact Mass | 718.48 |
| IUPAC Name | (2,6-ditert-butylcyclohexyl) 2-(4-tert-butyl-2-methylphenyl)-5-(diethylcarbamoyloxy)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate;N,N-dimethylacetamide |
| SMILES | CC(=O)N(C)C.[C-]#[N+]c1c(C(=O)OC2C(C(C)(C)C)CCCC2C(C)(C)C)c2nc(-c3ccc(C(C)(C)C)cc3C)[nH]n2c1OC(=O)N(CC)CC |
| InChI | InChI=1S/C37H53N5O4.C4H9NO/c1-14-41(15-2)34(44)46-32-28(38-13)27(33(43)45-29-25(36(7,8)9)17-16-18-26(29)37(10,11)12)31-39-30(40-42(31)32)24-20-19-23(21-22(24)3)35(4,5)6;1-4(6)5(2)3/h19-21,25-26,29H,14-18H2,1-12H3,(H,39,40);1-3H3 |
| InChIKey | FTBTWNOCQRSLPA-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.98 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|