C20H36N2O3 — CID 91285928
1-[2-(2-hydroxyethylamino)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol (PubChem CID 91285928) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethylamino)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol.
| Compound Name | 1-[2-(2-hydroxyethylamino)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91285928 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 1-[2-(2-hydroxyethylamino)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol |
| SMILES | C=C(Cc1cc(O)n(CCNCCO)c1O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H36N2O3/c1-15(13-20(5,6)14-19(2,3)4)11-16-12-17(24)22(18(16)25)9-7-21-8-10-23/h12,21,23-25H,1,7-11,13-14H2,2-6H3 |
| InChIKey | SPYDOOLEHWKIPQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|