C16H26N6O — CID 91285974
8-methoxy-9-(5-piperidin-1-ylpentyl)purin-6-amine (PubChem CID 91285974) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is 8-methoxy-9-(5-piperidin-1-ylpentyl)purin-6-amine.
| Compound Name | 8-methoxy-9-(5-piperidin-1-ylpentyl)purin-6-amine |
|---|---|
| PubChem CID | 91285974 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 8-methoxy-9-(5-piperidin-1-ylpentyl)purin-6-amine |
| SMILES | COc1nc2c(N)ncnc2n1CCCCCN1CCCCC1 |
| InChI | InChI=1S/C16H26N6O/c1-23-16-20-13-14(17)18-12-19-15(13)22(16)11-7-3-6-10-21-8-4-2-5-9-21/h12H,2-11H2,1H3,(H2,17,18,19) |
| InChIKey | ALZLXNOJRBFTJL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|