About 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole
4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole (PubChem CID 91286328) has the molecular formula C8H11F3N2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole.
Molecular Properties
| Compound Name | 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole |
| PubChem CID | 91286328 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole |
| SMILES | CC(C)c1cn[nH]c1CC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2/c1-5(2)6-4-12-13-7(6)3-8(9,10)11/h4-5H,3H2,1-2H3,(H,12,13) |
| InChIKey | AZEZSFANIGKTQQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole?
The IUPAC name of 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole (CID 91286328) is 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole.
What is the SMILES notation for 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole?
The canonical SMILES for 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole is CC(C)c1cn[nH]c1CC(F)(F)F.
What is the InChIKey of 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole?
The InChIKey is AZEZSFANIGKTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2/c1-5(2)6-4-12-13-7(6)3-8(9,10)11/h4-5H,3H2,1-2H3,(H,12,13).
What are the key properties of 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole?
4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole has a molecular weight of 192.18 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazole is sourced from PubChem (CID 91286328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).