C23H36F2O4 — CID 91286510
propan-2-yl 7-[2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopenten-1-yl]heptanoate (PubChem CID 91286510) has the molecular formula C23H36F2O4 and a molecular weight of 414.53 g/mol. Its IUPAC name is propan-2-yl 7-[2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopenten-1-yl]heptanoate.
| Compound Name | propan-2-yl 7-[2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 91286510 |
| Molecular Formula | C23H36F2O4 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | propan-2-yl 7-[2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopenten-1-yl]heptanoate |
| SMILES | CCCCC(F)(F)C(=O)CCC1=C(CCCCCCC(=O)OC(C)C)C(=O)CC1 |
| InChI | InChI=1S/C23H36F2O4/c1-4-5-16-23(24,25)21(27)15-13-18-12-14-20(26)19(18)10-8-6-7-9-11-22(28)29-17(2)3/h17H,4-16H2,1-3H3 |
| InChIKey | ITHGFWUGBBIFLN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|