C27H24F5N2O5+ — CID 91286623
2-[2-[5-methyl-2-(2-phenylethenyl)-1,3-oxazol-4-yl]ethoxy]-2-(2,2,3,3,3-pentafluoropropanoyl)-3,4-dihydro-1H-isoquinolin-2-ium-1-carboxylic acid (PubChem CID 91286623) has the molecular formula C27H24F5N2O5+ and a molecular weight of 551.49 g/mol. Its IUPAC name is 2-[2-[5-methyl-2-(2-phenylethenyl)-1,3-oxazol-4-yl]ethoxy]-2-(2,2,3,3,3-pentafluoropropanoyl)-3,4-dihydro-1H-isoquinolin-2-ium-1-carboxylic acid.
| Compound Name | 2-[2-[5-methyl-2-(2-phenylethenyl)-1,3-oxazol-4-yl]ethoxy]-2-(2,2,3,3,3-pentafluoropropanoyl)-3,4-dihydro-1H-isoquinolin-2-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 91286623 |
| Molecular Formula | C27H24F5N2O5+ |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 2-[2-[5-methyl-2-(2-phenylethenyl)-1,3-oxazol-4-yl]ethoxy]-2-(2,2,3,3,3-pentafluoropropanoyl)-3,4-dihydro-1H-isoquinolin-2-ium-1-carboxylic acid |
| SMILES | Cc1oc(C=Cc2ccccc2)nc1CCO[N+]1(C(=O)C(F)(F)C(F)(F)F)CCc2ccccc2C1C(=O)O |
| InChI | InChI=1S/C27H23F5N2O5/c1-17-21(33-22(39-17)12-11-18-7-3-2-4-8-18)14-16-38-34(25(37)26(28,29)27(30,31)32)15-13-19-9-5-6-10-20(19)23(34)24(35)36/h2-12,23H,13-16H2,1H3/p+1 |
| InChIKey | DEYBWTLQKFOBAU-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|