About 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine
1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine (PubChem CID 91286888) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine |
| PubChem CID | 91286888 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine |
| SMILES | CNNC1=CCN(C)CC1 |
| InChI | InChI=1S/C7H15N3/c1-8-9-7-3-5-10(2)6-4-7/h3,8-9H,4-6H2,1-2H3 |
| InChIKey | JSKXYLKGXGSHOD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine?
The IUPAC name of 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine (CID 91286888) is 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine.
What is the SMILES notation for 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine?
The canonical SMILES for 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine is CNNC1=CCN(C)CC1.
What is the InChIKey of 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine?
The InChIKey is JSKXYLKGXGSHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-8-9-7-3-5-10(2)6-4-7/h3,8-9H,4-6H2,1-2H3.
What are the key properties of 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine?
1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine has a molecular weight of 141.22 g/mol, XLogP of -0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)hydrazine is sourced from PubChem (CID 91286888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).