About 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid
3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid (PubChem CID 91287019) has the molecular formula C10H8ClF2NO2
and a molecular weight of 247.63 g/mol. Its IUPAC name is 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid |
| PubChem CID | 91287019 |
| Molecular Formula | C10H8ClF2NO2 |
| Molecular Weight | 247.63 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)c(N(Cl)C2CC2)c1 |
| InChI | InChI=1S/C10H8ClF2NO2/c11-14(6-1-2-6)8-4-5(10(15)16)3-7(12)9(8)13/h3-4,6H,1-2H2,(H,15,16) |
| InChIKey | SVZFYCYTWBBCIR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid?
The IUPAC name of 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid (CID 91287019) is 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid.
What is the SMILES notation for 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid?
The canonical SMILES for 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid is O=C(O)c1cc(F)c(F)c(N(Cl)C2CC2)c1.
What is the InChIKey of 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid?
The InChIKey is SVZFYCYTWBBCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClF2NO2/c11-14(6-1-2-6)8-4-5(10(15)16)3-7(12)9(8)13/h3-4,6H,1-2H2,(H,15,16).
What are the key properties of 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid?
3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid has a molecular weight of 247.63 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro(cyclopropyl)amino]-4,5-difluorobenzoic acid is sourced from PubChem (CID 91287019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).