About 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid
5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid (PubChem CID 91287369) has the molecular formula C21H25N3O2
and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid.
Molecular Properties
| Compound Name | 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid |
| PubChem CID | 91287369 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid |
| SMILES | CCc1nc2cc(C)c(C)nc2n1-c1ccc(CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-4-19-23-18-13-14(2)15(3)22-21(18)24(19)17-11-9-16(10-12-17)7-5-6-8-20(25)26/h9-13H,4-8H2,1-3H3,(H,25,26) |
| InChIKey | GGEKRQUYQCQVLV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid?
The IUPAC name of 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid (CID 91287369) is 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid.
What is the SMILES notation for 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid?
The canonical SMILES for 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid is CCc1nc2cc(C)c(C)nc2n1-c1ccc(CCCCC(=O)O)cc1.
What is the InChIKey of 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid?
The InChIKey is GGEKRQUYQCQVLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O2/c1-4-19-23-18-13-14(2)15(3)22-21(18)24(19)17-11-9-16(10-12-17)7-5-6-8-20(25)26/h9-13H,4-8H2,1-3H3,(H,25,26).
What are the key properties of 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid?
5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid has a molecular weight of 351.45 g/mol, XLogP of 4.40, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2-ethyl-5,6-dimethylimidazo[4,5-b]pyridin-3-yl)phenyl]pentanoic acid is sourced from PubChem (CID 91287369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).