C19H18O2S — CID 91287433
(1S,5R)-3-(2-methyl-5-thiophen-3-ylphenyl)bicyclo[3.2.1]octane-2,4-dione (PubChem CID 91287433) has the molecular formula C19H18O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is (1S,5R)-3-(2-methyl-5-thiophen-3-ylphenyl)bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5R)-3-(2-methyl-5-thiophen-3-ylphenyl)bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91287433 |
| Molecular Formula | C19H18O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (1S,5R)-3-(2-methyl-5-thiophen-3-ylphenyl)bicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1ccc(-c2ccsc2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C19H18O2S/c1-11-2-3-12(15-6-7-22-10-15)9-16(11)17-18(20)13-4-5-14(8-13)19(17)21/h2-3,6-7,9-10,13-14,17H,4-5,8H2,1H3/t13-,14+,17? |
| InChIKey | AWXMKXXYHNXVSZ-VMZNBEPHSA-N |
| XLogP | 4.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|