C21H31NO7 — CID 91287571
[(2R,3R)-3-cycloheptyloxycarbonyloxybutan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 91287571) has the molecular formula C21H31NO7 and a molecular weight of 409.48 g/mol. Its IUPAC name is [(2R,3R)-3-cycloheptyloxycarbonyloxybutan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | [(2R,3R)-3-cycloheptyloxycarbonyloxybutan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 91287571 |
| Molecular Formula | C21H31NO7 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [(2R,3R)-3-cycloheptyloxycarbonyloxybutan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | C[C@@H](OC(=O)OC1CCCCCC1)[C@@H](C)OC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H31NO7/c1-13(14(2)28-21(26)29-16-7-5-3-4-6-8-16)27-20(25)17(22)11-15-9-10-18(23)19(24)12-15/h9-10,12-14,16-17,23-24H,3-8,11,22H2,1-2H3/t13-,14-,17+/m1/s1 |
| InChIKey | IUEYOUXKUQROSH-CPUCHLNUSA-N |
| XLogP | 3.16 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|