C22H27N7O — CID 91287950
N-[(4-aminophenyl)methyl]-N-methyl-1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidine-3-carboxamide (PubChem CID 91287950) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-methyl-1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidine-3-carboxamide.
| Compound Name | N-[(4-aminophenyl)methyl]-N-methyl-1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 91287950 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-methyl-1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidine-3-carboxamide |
| SMILES | CN(Cc1ccc(N)cc1)C(=O)C1CN(c2c3c(nc4ccnn24)CCNCC3)C1 |
| InChI | InChI=1S/C22H27N7O/c1-27(12-15-2-4-17(23)5-3-15)22(30)16-13-28(14-16)21-18-6-9-24-10-7-19(18)26-20-8-11-25-29(20)21/h2-5,8,11,16,24H,6-7,9-10,12-14,23H2,1H3 |
| InChIKey | NFMOIWRDWVAOJC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|