C19H26O2 — CID 91288179
(8S,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-4,5,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 91288179) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-4,5,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-4,5,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91288179 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (8S,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-4,5,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C=CC3C(O)C(=O)C=C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H26O2/c1-18-9-3-4-13(18)12-5-6-15-17(21)16(20)8-11-19(15,2)14(12)7-10-18/h5-6,8,11-15,17,21H,3-4,7,9-10H2,1-2H3/t12-,13-,14-,15?,17?,18-,19+/m0/s1 |
| InChIKey | FDSIKDRMGDPDGJ-SAHUHGIGSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|