C40H44N4O7S — CID 91288346
(4S)-2-[2-[[[(3S)-3-(2-amino-3-methylbutanoyl)oxy-7-tritylsulfanylhept-4-enoyl]amino]methyl]-1,3-oxazol-4-yl]-4-methyl-5H-1,3-oxazole-4-carboxylic acid (PubChem CID 91288346) has the molecular formula C40H44N4O7S and a molecular weight of 724.88 g/mol. Its IUPAC name is (4S)-2-[2-[[[(3S)-3-(2-amino-3-methylbutanoyl)oxy-7-tritylsulfanylhept-4-enoyl]amino]methyl]-1,3-oxazol-4-yl]-4-methyl-5H-1,3-oxazole-4-carboxylic acid.
| Compound Name | (4S)-2-[2-[[[(3S)-3-(2-amino-3-methylbutanoyl)oxy-7-tritylsulfanylhept-4-enoyl]amino]methyl]-1,3-oxazol-4-yl]-4-methyl-5H-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 91288346 |
| Molecular Formula | C40H44N4O7S |
| Molecular Weight | 724.88 g/mol |
| Exact Mass | 724.29 |
| IUPAC Name | (4S)-2-[2-[[[(3S)-3-(2-amino-3-methylbutanoyl)oxy-7-tritylsulfanylhept-4-enoyl]amino]methyl]-1,3-oxazol-4-yl]-4-methyl-5H-1,3-oxazole-4-carboxylic acid |
| SMILES | CC(C)C(N)C(=O)O[C@H](C=CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)NCc1nc(C2=N[C@](C)(C(=O)O)CO2)co1 |
| InChI | InChI=1S/C40H44N4O7S/c1-27(2)35(41)37(46)51-31(23-33(45)42-24-34-43-32(25-49-34)36-44-39(3,26-50-36)38(47)48)21-13-14-22-52-40(28-15-7-4-8-16-28,29-17-9-5-10-18-29)30-19-11-6-12-20-30/h4-13,15-21,25,27,31,35H,14,22-24,26,41H2,1-3H3,(H,42,45)(H,47,48)/t31-,35?,39+/m1/s1 |
| InChIKey | YBIPUFIYBQKLHI-SIQKPIHPSA-N |
| XLogP | 5.87 |
| TPSA | 166.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.88 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|