C12H17N — CID 91288553
1,3-dimethyl-5-penta-1,4-dienyl-2,6-dihydropyridine (PubChem CID 91288553) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 1,3-dimethyl-5-penta-1,4-dienyl-2,6-dihydropyridine.
| Compound Name | 1,3-dimethyl-5-penta-1,4-dienyl-2,6-dihydropyridine |
|---|---|
| PubChem CID | 91288553 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1,3-dimethyl-5-penta-1,4-dienyl-2,6-dihydropyridine |
| SMILES | C=CCC=CC1=C=C(C)CN(C)C1 |
| InChI | InChI=1S/C12H17N/c1-4-5-6-7-12-8-11(2)9-13(3)10-12/h4,6-7H,1,5,9-10H2,2-3H3 |
| InChIKey | JVFWWAFZUNGEAZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|