C52H56F2N8O6S2 — CID 91288889
1-N,4-N-bis[1-(2-amino-2-cyclohexylacetyl)-5-[4-(4-fluorobenzoyl)-1,3-thiazol-2-yl]pyrrolidin-3-yl]benzene-1,4-dicarboxamide (PubChem CID 91288889) has the molecular formula C52H56F2N8O6S2 and a molecular weight of 991.20 g/mol. Its IUPAC name is 1-N,4-N-bis[1-(2-amino-2-cyclohexylacetyl)-5-[4-(4-fluorobenzoyl)-1,3-thiazol-2-yl]pyrrolidin-3-yl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[1-(2-amino-2-cyclohexylacetyl)-5-[4-(4-fluorobenzoyl)-1,3-thiazol-2-yl]pyrrolidin-3-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 91288889 |
| Molecular Formula | C52H56F2N8O6S2 |
| Molecular Weight | 991.20 g/mol |
| Exact Mass | 990.37 |
| IUPAC Name | 1-N,4-N-bis[1-(2-amino-2-cyclohexylacetyl)-5-[4-(4-fluorobenzoyl)-1,3-thiazol-2-yl]pyrrolidin-3-yl]benzene-1,4-dicarboxamide |
| SMILES | NC(C(=O)N1CC(NC(=O)c2ccc(C(=O)NC3CC(c4nc(C(=O)c5ccc(F)cc5)cs4)N(C(=O)C(N)C4CCCCC4)C3)cc2)CC1c1nc(C(=O)c2ccc(F)cc2)cs1)C1CCCCC1 |
| InChI | InChI=1S/C52H56F2N8O6S2/c53-35-19-15-31(16-20-35)45(63)39-27-69-49(59-39)41-23-37(25-61(41)51(67)43(55)29-7-3-1-4-8-29)57-47(65)33-11-13-34(14-12-33)48(66)58-38-24-42(62(26-38)52(68)44(56)30-9-5-2-6-10-30)50-60-40(28-70-50)46(64)32-17-21-36(54)22-18-32/h11-22,27-30,37-38,41-44H,1-10,23-26,55-56H2,(H,57,65)(H,58,66) |
| InChIKey | XHPKVNJOUUDALT-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 210.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.20 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |