About ethane;3-hydroxy-1,2-dimethylquinolin-4-one
ethane;3-hydroxy-1,2-dimethylquinolin-4-one (PubChem CID 91289410) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is ethane;3-hydroxy-1,2-dimethylquinolin-4-one.
Molecular Properties
| Compound Name | ethane;3-hydroxy-1,2-dimethylquinolin-4-one |
| PubChem CID | 91289410 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | ethane;3-hydroxy-1,2-dimethylquinolin-4-one |
| SMILES | CC.Cc1c(O)c(=O)c2ccccc2n1C |
| InChI | InChI=1S/C11H11NO2.C2H6/c1-7-10(13)11(14)8-5-3-4-6-9(8)12(7)2;1-2/h3-6,13H,1-2H3;1-2H3 |
| InChIKey | QEZCISWXMCKDBE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-hydroxy-1,2-dimethylquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-hydroxy-1,2-dimethylquinolin-4-one?
The IUPAC name of ethane;3-hydroxy-1,2-dimethylquinolin-4-one (CID 91289410) is ethane;3-hydroxy-1,2-dimethylquinolin-4-one.
What is the SMILES notation for ethane;3-hydroxy-1,2-dimethylquinolin-4-one?
The canonical SMILES for ethane;3-hydroxy-1,2-dimethylquinolin-4-one is CC.Cc1c(O)c(=O)c2ccccc2n1C.
What is the InChIKey of ethane;3-hydroxy-1,2-dimethylquinolin-4-one?
The InChIKey is QEZCISWXMCKDBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2.C2H6/c1-7-10(13)11(14)8-5-3-4-6-9(8)12(7)2;1-2/h3-6,13H,1-2H3;1-2H3.
What are the key properties of ethane;3-hydroxy-1,2-dimethylquinolin-4-one?
ethane;3-hydroxy-1,2-dimethylquinolin-4-one has a molecular weight of 219.28 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-hydroxy-1,2-dimethylquinolin-4-one is sourced from PubChem (CID 91289410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).