C11H12F8O2 — CID 91290223
1,1,2,2,2-pentafluoroethyl 3,3-difluoro-2-(1-fluoroethylidene)heptanoate (PubChem CID 91290223) has the molecular formula C11H12F8O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl 3,3-difluoro-2-(1-fluoroethylidene)heptanoate.
| Compound Name | 1,1,2,2,2-pentafluoroethyl 3,3-difluoro-2-(1-fluoroethylidene)heptanoate |
|---|---|
| PubChem CID | 91290223 |
| Molecular Formula | C11H12F8O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl 3,3-difluoro-2-(1-fluoroethylidene)heptanoate |
| SMILES | CCCCC(F)(F)C(C(=O)OC(F)(F)C(F)(F)F)=C(C)F |
| InChI | InChI=1S/C11H12F8O2/c1-3-4-5-9(13,14)7(6(2)12)8(20)21-11(18,19)10(15,16)17/h3-5H2,1-2H3 |
| InChIKey | WWBLULIJWIVBKR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|