About 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one
2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one (PubChem CID 91290993) has the molecular formula C11H11N2O+
and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one.
Molecular Properties
| Compound Name | 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one |
| PubChem CID | 91290993 |
| Molecular Formula | C11H11N2O+ |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one |
| SMILES | CC1C[N+]12C=Nc1ccccc1C2=O |
| InChI | InChI=1S/C11H11N2O/c1-8-6-13(8)7-12-10-5-3-2-4-9(10)11(13)14/h2-5,7-8H,6H2,1H3/q+1 |
| InChIKey | IOARQEWABNZCJE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one?
The IUPAC name of 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one (CID 91290993) is 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one.
What is the SMILES notation for 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one?
The canonical SMILES for 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one is CC1C[N+]12C=Nc1ccccc1C2=O.
What is the InChIKey of 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one?
The InChIKey is IOARQEWABNZCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N2O/c1-8-6-13(8)7-12-10-5-3-2-4-9(10)11(13)14/h2-5,7-8H,6H2,1H3/q+1.
What are the key properties of 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one?
2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one has a molecular weight of 187.22 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylspiro[aziridin-1-ium-1,3'-quinazolin-3-ium]-4'-one is sourced from PubChem (CID 91290993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).