C25H20N3OS+ — CID 91291264
2-[3-methyl-2-(1-methylquinolin-1-ium-4-yl)-2H-1,3-benzothiazol-6-yl]-1,3-benzoxazole (PubChem CID 91291264) has the molecular formula C25H20N3OS+ and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[3-methyl-2-(1-methylquinolin-1-ium-4-yl)-2H-1,3-benzothiazol-6-yl]-1,3-benzoxazole.
| Compound Name | 2-[3-methyl-2-(1-methylquinolin-1-ium-4-yl)-2H-1,3-benzothiazol-6-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 91291264 |
| Molecular Formula | C25H20N3OS+ |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[3-methyl-2-(1-methylquinolin-1-ium-4-yl)-2H-1,3-benzothiazol-6-yl]-1,3-benzoxazole |
| SMILES | CN1c2ccc(-c3nc4ccccc4o3)cc2SC1c1cc[n+](C)c2ccccc12 |
| InChI | InChI=1S/C25H20N3OS/c1-27-14-13-18(17-7-3-5-9-20(17)27)25-28(2)21-12-11-16(15-23(21)30-25)24-26-19-8-4-6-10-22(19)29-24/h3-15,25H,1-2H3/q+1 |
| InChIKey | JNNBWQJJASLYBV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 33.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|