About 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine
2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine (PubChem CID 91291281) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine.
Molecular Properties
| Compound Name | 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine |
| PubChem CID | 91291281 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine |
| SMILES | C=NC(C)=C(C=CCCN)C=CC(=CCCC)CN |
| InChI | InChI=1S/C16H27N3/c1-4-5-8-15(13-18)10-11-16(14(2)19-3)9-6-7-12-17/h6,8-11H,3-5,7,12-13,17-18H2,1-2H3 |
| InChIKey | XSNFIASVFPAWNZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine?
The IUPAC name of 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine (CID 91291281) is 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine.
What is the SMILES notation for 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine?
The canonical SMILES for 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine is C=NC(C)=C(C=CCCN)C=CC(=CCCC)CN.
What is the InChIKey of 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine?
The InChIKey is XSNFIASVFPAWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3/c1-4-5-8-15(13-18)10-11-16(14(2)19-3)9-6-7-12-17/h6,8-11H,3-5,7,12-13,17-18H2,1-2H3.
What are the key properties of 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine?
2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine has a molecular weight of 261.41 g/mol, XLogP of 3.11, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylidene-5-[1-(methylideneamino)ethylidene]nona-3,6-diene-1,9-diamine is sourced from PubChem (CID 91291281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).