C24H25ClN4O4S — CID 91291465
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(7H-purin-2-ylsulfanyl)oxane-2,4-dione (PubChem CID 91291465) has the molecular formula C24H25ClN4O4S and a molecular weight of 501.01 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(7H-purin-2-ylsulfanyl)oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(7H-purin-2-ylsulfanyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 91291465 |
| Molecular Formula | C24H25ClN4O4S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-(7H-purin-2-ylsulfanyl)oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3ncc4[nH]cnc4n3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C24H25ClN4O4S/c1-32-19-7-6-14(10-16(19)25)8-9-24(15-4-2-3-5-15)11-18(30)20(22(31)33-24)34-23-26-12-17-21(29-23)28-13-27-17/h6-7,10,12-13,15,20H,2-5,8-9,11H2,1H3,(H,26,27,28,29) |
| InChIKey | YYCCVZAYSNILCO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|