About 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one
6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one (PubChem CID 91292112) has the molecular formula C19H36O4
and a molecular weight of 328.49 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one.
Molecular Properties
| Compound Name | 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one |
| PubChem CID | 91292112 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one |
| SMILES | CCCCCCCCC(=O)C(=CC(CCC)(OC)OC)CCO |
| InChI | InChI=1S/C19H36O4/c1-5-7-8-9-10-11-12-18(21)17(13-15-20)16-19(22-3,23-4)14-6-2/h16,20H,5-15H2,1-4H3 |
| InChIKey | SWGQRPYDPTUCTF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one?
The IUPAC name of 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one (CID 91292112) is 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one.
What is the SMILES notation for 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one?
The canonical SMILES for 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one is CCCCCCCCC(=O)C(=CC(CCC)(OC)OC)CCO.
What is the InChIKey of 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one?
The InChIKey is SWGQRPYDPTUCTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O4/c1-5-7-8-9-10-11-12-18(21)17(13-15-20)16-19(22-3,23-4)14-6-2/h16,20H,5-15H2,1-4H3.
What are the key properties of 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one?
6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one has a molecular weight of 328.49 g/mol, XLogP of 4.40, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-hydroxyethyl)-4,4-dimethoxypentadec-5-en-7-one is sourced from PubChem (CID 91292112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).