About 1-butyl-2-(1,4-dioxan-2-yl)imidazole
1-butyl-2-(1,4-dioxan-2-yl)imidazole (PubChem CID 91292154) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-butyl-2-(1,4-dioxan-2-yl)imidazole.
Molecular Properties
| Compound Name | 1-butyl-2-(1,4-dioxan-2-yl)imidazole |
| PubChem CID | 91292154 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-butyl-2-(1,4-dioxan-2-yl)imidazole |
| SMILES | CCCCn1ccnc1C1COCCO1 |
| InChI | InChI=1S/C11H18N2O2/c1-2-3-5-13-6-4-12-11(13)10-9-14-7-8-15-10/h4,6,10H,2-3,5,7-9H2,1H3 |
| InChIKey | RPYFOJJQMVIQBA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-2-(1,4-dioxan-2-yl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-(1,4-dioxan-2-yl)imidazole?
The IUPAC name of 1-butyl-2-(1,4-dioxan-2-yl)imidazole (CID 91292154) is 1-butyl-2-(1,4-dioxan-2-yl)imidazole.
What is the SMILES notation for 1-butyl-2-(1,4-dioxan-2-yl)imidazole?
The canonical SMILES for 1-butyl-2-(1,4-dioxan-2-yl)imidazole is CCCCn1ccnc1C1COCCO1.
What is the InChIKey of 1-butyl-2-(1,4-dioxan-2-yl)imidazole?
The InChIKey is RPYFOJJQMVIQBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-2-3-5-13-6-4-12-11(13)10-9-14-7-8-15-10/h4,6,10H,2-3,5,7-9H2,1H3.
What are the key properties of 1-butyl-2-(1,4-dioxan-2-yl)imidazole?
1-butyl-2-(1,4-dioxan-2-yl)imidazole has a molecular weight of 210.28 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-(1,4-dioxan-2-yl)imidazole is sourced from PubChem (CID 91292154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).