C32H37FN3O5+ — CID 91292697
[(3R,5R)-4-(3-fluoro-2-methylphenyl)-3,5-bis(3-hydroxybenzoyl)piperidin-1-yl]carbamoyl-dimethyl-propylazanium (PubChem CID 91292697) has the molecular formula C32H37FN3O5+ and a molecular weight of 562.66 g/mol. Its IUPAC name is [(3R,5R)-4-(3-fluoro-2-methylphenyl)-3,5-bis(3-hydroxybenzoyl)piperidin-1-yl]carbamoyl-dimethyl-propylazanium.
| Compound Name | [(3R,5R)-4-(3-fluoro-2-methylphenyl)-3,5-bis(3-hydroxybenzoyl)piperidin-1-yl]carbamoyl-dimethyl-propylazanium |
|---|---|
| PubChem CID | 91292697 |
| Molecular Formula | C32H37FN3O5+ |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | [(3R,5R)-4-(3-fluoro-2-methylphenyl)-3,5-bis(3-hydroxybenzoyl)piperidin-1-yl]carbamoyl-dimethyl-propylazanium |
| SMILES | CCC[N+](C)(C)C(=O)NN1C[C@H](C(=O)c2cccc(O)c2)C(c2cccc(F)c2C)[C@@H](C(=O)c2cccc(O)c2)C1 |
| InChI | InChI=1S/C32H36FN3O5/c1-5-15-36(3,4)32(41)34-35-18-26(30(39)21-9-6-11-23(37)16-21)29(25-13-8-14-28(33)20(25)2)27(19-35)31(40)22-10-7-12-24(38)17-22/h6-14,16-17,26-27,29H,5,15,18-19H2,1-4H3,(H2-,34,37,38,41)/p+1/t26-,27-/m0/s1 |
| InChIKey | QXMQYJMERCRCMG-SVBPBHIXSA-O |
| XLogP | 5.05 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|