C40H39NO6 — CID 91292877
4,19-diethyl-11-methyl-8,16-bis(phenylmethoxy)-6-oxa-7-azahexacyclo[11.8.2.01,13.03,11.05,9.015,20]tricosa-5(9),7,15,17,19-pentaene-10,12,14-trione (PubChem CID 91292877) has the molecular formula C40H39NO6 and a molecular weight of 629.75 g/mol. Its IUPAC name is 4,19-diethyl-11-methyl-8,16-bis(phenylmethoxy)-6-oxa-7-azahexacyclo[11.8.2.01,13.03,11.05,9.015,20]tricosa-5(9),7,15,17,19-pentaene-10,12,14-trione.
| Compound Name | 4,19-diethyl-11-methyl-8,16-bis(phenylmethoxy)-6-oxa-7-azahexacyclo[11.8.2.01,13.03,11.05,9.015,20]tricosa-5(9),7,15,17,19-pentaene-10,12,14-trione |
|---|---|
| PubChem CID | 91292877 |
| Molecular Formula | C40H39NO6 |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | 4,19-diethyl-11-methyl-8,16-bis(phenylmethoxy)-6-oxa-7-azahexacyclo[11.8.2.01,13.03,11.05,9.015,20]tricosa-5(9),7,15,17,19-pentaene-10,12,14-trione |
| SMILES | CCc1ccc(OCc2ccccc2)c2c1CC13CCC1(C2=O)C(=O)C1(C)C(=O)c2c(OCc4ccccc4)noc2C(CC)C1C3 |
| InChI | InChI=1S/C40H39NO6/c1-4-26-16-17-30(45-22-24-12-8-6-9-13-24)31-28(26)20-39-18-19-40(39,35(31)43)37(44)38(3)29(21-39)27(5-2)33-32(34(38)42)36(41-47-33)46-23-25-14-10-7-11-15-25/h6-17,27,29H,4-5,18-23H2,1-3H3 |
| InChIKey | RUWSABZBOFVMJC-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 95.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|