C10H17NO5 — CID 91293083
dimethyl 4-(hydroxymethyl)piperidine-2,6-dicarboxylate (PubChem CID 91293083) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is dimethyl 4-(hydroxymethyl)piperidine-2,6-dicarboxylate.
| Compound Name | dimethyl 4-(hydroxymethyl)piperidine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 91293083 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | dimethyl 4-(hydroxymethyl)piperidine-2,6-dicarboxylate |
| SMILES | COC(=O)C1CC(CO)CC(C(=O)OC)N1 |
| InChI | InChI=1S/C10H17NO5/c1-15-9(13)7-3-6(5-12)4-8(11-7)10(14)16-2/h6-8,11-12H,3-5H2,1-2H3 |
| InChIKey | YRTQGHCWWVEXOR-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |