C26H31FO4 — CID 91293239
2,6-diethyl-4-[2-ethyl-4-(4-fluoro-3-methoxyphenyl)phenyl]-2,6-dimethyloxane-3,5-dione (PubChem CID 91293239) has the molecular formula C26H31FO4 and a molecular weight of 426.53 g/mol. Its IUPAC name is 2,6-diethyl-4-[2-ethyl-4-(4-fluoro-3-methoxyphenyl)phenyl]-2,6-dimethyloxane-3,5-dione.
| Compound Name | 2,6-diethyl-4-[2-ethyl-4-(4-fluoro-3-methoxyphenyl)phenyl]-2,6-dimethyloxane-3,5-dione |
|---|---|
| PubChem CID | 91293239 |
| Molecular Formula | C26H31FO4 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2,6-diethyl-4-[2-ethyl-4-(4-fluoro-3-methoxyphenyl)phenyl]-2,6-dimethyloxane-3,5-dione |
| SMILES | CCc1cc(-c2ccc(F)c(OC)c2)ccc1C1C(=O)C(C)(CC)OC(C)(CC)C1=O |
| InChI | InChI=1S/C26H31FO4/c1-7-16-14-17(18-11-13-20(27)21(15-18)30-6)10-12-19(16)22-23(28)25(4,8-2)31-26(5,9-3)24(22)29/h10-15,22H,7-9H2,1-6H3 |
| InChIKey | KPIPYSJRYXZLQC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|