C17H25F3N4O5 — CID 91293930
[4-(methylamino)phenyl]methyl N-[(2R)-1-hydrazinyl-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 91293930) has the molecular formula C17H25F3N4O5 and a molecular weight of 422.40 g/mol. Its IUPAC name is [4-(methylamino)phenyl]methyl N-[(2R)-1-hydrazinyl-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(methylamino)phenyl]methyl N-[(2R)-1-hydrazinyl-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 91293930 |
| Molecular Formula | C17H25F3N4O5 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [4-(methylamino)phenyl]methyl N-[(2R)-1-hydrazinyl-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CNc1ccc(COC(=O)N[C@H](CC(C)C)C(=O)NN)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O3.C2HF3O2/c1-10(2)8-13(14(20)19-16)18-15(21)22-9-11-4-6-12(17-3)7-5-11;3-2(4,5)1(6)7/h4-7,10,13,17H,8-9,16H2,1-3H3,(H,18,21)(H,19,20);(H,6,7)/t13-;/m1./s1 |
| InChIKey | HHPVYOURCHBAFY-BTQNPOSSSA-N |
| XLogP | 1.99 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|