About 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide
7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide (PubChem CID 91293974) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide |
| PubChem CID | 91293974 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide |
| SMILES | Cn1cc(C(N)=O)c(=O)c2ccsc21 |
| InChI | InChI=1S/C9H8N2O2S/c1-11-4-6(8(10)13)7(12)5-2-3-14-9(5)11/h2-4H,1H3,(H2,10,13) |
| InChIKey | JUKCBBFSSBVYGK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide?
The IUPAC name of 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide (CID 91293974) is 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide.
What is the SMILES notation for 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide?
The canonical SMILES for 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide is Cn1cc(C(N)=O)c(=O)c2ccsc21.
What is the InChIKey of 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide?
The InChIKey is JUKCBBFSSBVYGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c1-11-4-6(8(10)13)7(12)5-2-3-14-9(5)11/h2-4H,1H3,(H2,10,13).
What are the key properties of 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide?
7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide has a molecular weight of 208.24 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4-oxothieno[2,3-b]pyridine-5-carboxamide is sourced from PubChem (CID 91293974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).