C18H30O10S — CID 91294190
(3S,6S)-2-(hydroxymethyl)-6-[[(6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfanyl]oxane-3,4,5-triol (PubChem CID 91294190) has the molecular formula C18H30O10S and a molecular weight of 438.50 g/mol. Its IUPAC name is (3S,6S)-2-(hydroxymethyl)-6-[[(6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfanyl]oxane-3,4,5-triol.
| Compound Name | (3S,6S)-2-(hydroxymethyl)-6-[[(6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfanyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91294190 |
| Molecular Formula | C18H30O10S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (3S,6S)-2-(hydroxymethyl)-6-[[(6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfanyl]oxane-3,4,5-triol |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(CS[C@@H]3OC(CO)[C@@H](O)C(O)C3O)O[C@@H]2O1 |
| InChI | InChI=1S/C18H30O10S/c1-17(2)25-12-8(23-15-14(13(12)26-17)27-18(3,4)28-15)6-29-16-11(22)10(21)9(20)7(5-19)24-16/h7-16,19-22H,5-6H2,1-4H3/t7?,8?,9-,10?,11?,12+,13?,14?,15-,16+/m1/s1 |
| InChIKey | CCGYLXGSTVNGDG-BDZKWMFTSA-N |
| XLogP | -1.08 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |