C41H76O5 — CID 91294429
12-(2,3-dihydroxypropoxy)-11-pentadeca-6,9-dienyltricosane-10,14-dione (PubChem CID 91294429) has the molecular formula C41H76O5 and a molecular weight of 649.05 g/mol. Its IUPAC name is 12-(2,3-dihydroxypropoxy)-11-pentadeca-6,9-dienyltricosane-10,14-dione.
| Compound Name | 12-(2,3-dihydroxypropoxy)-11-pentadeca-6,9-dienyltricosane-10,14-dione |
|---|---|
| PubChem CID | 91294429 |
| Molecular Formula | C41H76O5 |
| Molecular Weight | 649.05 g/mol |
| Exact Mass | 648.57 |
| IUPAC Name | 12-(2,3-dihydroxypropoxy)-11-pentadeca-6,9-dienyltricosane-10,14-dione |
| SMILES | CCCCCC=CCC=CCCCCCC(C(=O)CCCCCCCCC)C(CC(=O)CCCCCCCCC)OCC(O)CO |
| InChI | InChI=1S/C41H76O5/c1-4-7-10-13-16-17-18-19-20-21-24-26-29-32-39(40(45)33-30-27-23-15-12-9-6-3)41(46-36-38(44)35-42)34-37(43)31-28-25-22-14-11-8-5-2/h16-17,19-20,38-39,41-42,44H,4-15,18,21-36H2,1-3H3 |
| InChIKey | FOPYSYRCWZICPV-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.05 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|