C18H19N — CID 91294515
1-(11-tricyclo[7.3.1.02,7]trideca-1,3,5,7,9,11-hexaenyl)piperidine (PubChem CID 91294515) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(11-tricyclo[7.3.1.02,7]trideca-1,3,5,7,9,11-hexaenyl)piperidine.
| Compound Name | 1-(11-tricyclo[7.3.1.02,7]trideca-1,3,5,7,9,11-hexaenyl)piperidine |
|---|---|
| PubChem CID | 91294515 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(11-tricyclo[7.3.1.02,7]trideca-1,3,5,7,9,11-hexaenyl)piperidine |
| SMILES | C1=C2C=c3ccccc3=C(C=C1N1CCCCC1)C2 |
| InChI | InChI=1S/C18H19N/c1-4-8-19(9-5-1)17-12-14-10-15-6-2-3-7-18(15)16(11-14)13-17/h2-3,6-7,10,12-13H,1,4-5,8-9,11H2 |
| InChIKey | UTEMBKHDZMLROH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |