About ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate
ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate (PubChem CID 91294786) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate.
Molecular Properties
| Compound Name | ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate |
| PubChem CID | 91294786 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(CO)C1CCc2cc(NC(C)=O)ccc2O1 |
| InChI | InChI=1S/C16H21NO5/c1-3-21-16(20)13(9-18)15-6-4-11-8-12(17-10(2)19)5-7-14(11)22-15/h5,7-8,13,15,18H,3-4,6,9H2,1-2H3,(H,17,19) |
| InChIKey | JYUNJEKEGPLVHT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate?
The IUPAC name of ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate (CID 91294786) is ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate.
What is the SMILES notation for ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate?
The canonical SMILES for ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate is CCOC(=O)C(CO)C1CCc2cc(NC(C)=O)ccc2O1.
What is the InChIKey of ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate?
The InChIKey is JYUNJEKEGPLVHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO5/c1-3-21-16(20)13(9-18)15-6-4-11-8-12(17-10(2)19)5-7-14(11)22-15/h5,7-8,13,15,18H,3-4,6,9H2,1-2H3,(H,17,19).
What are the key properties of ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate?
ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate has a molecular weight of 307.35 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)-3-hydroxypropanoate is sourced from PubChem (CID 91294786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).